C21H25NO3 — CID 24593104
(2,3,6-trimethylphenyl) 3-acetamido-3-(4-methylphenyl)propanoate (PubChem CID 24593104) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 3-acetamido-3-(4-methylphenyl)propanoate.
| Compound Name | (2,3,6-trimethylphenyl) 3-acetamido-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 24593104 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2,3,6-trimethylphenyl) 3-acetamido-3-(4-methylphenyl)propanoate |
| SMILES | CC(=O)NC(CC(=O)Oc1c(C)ccc(C)c1C)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-13-6-10-18(11-7-13)19(22-17(5)23)12-20(24)25-21-15(3)9-8-14(2)16(21)4/h6-11,19H,12H2,1-5H3,(H,22,23) |
| InChIKey | KKSJIYFSFUPJBB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|