About [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate
[2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate (PubChem CID 24593473) has the molecular formula C20H19ClN2O4
and a molecular weight of 386.84 g/mol. Its IUPAC name is [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate |
| PubChem CID | 24593473 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate |
| SMILES | Cc1oc(NC(=O)COC(=O)C2(c3ccc(Cl)cc3)CCC2)c(C#N)c1C |
| InChI | InChI=1S/C20H19ClN2O4/c1-12-13(2)27-18(16(12)10-22)23-17(24)11-26-19(25)20(8-3-9-20)14-4-6-15(21)7-5-14/h4-7H,3,8-9,11H2,1-2H3,(H,23,24) |
| InChIKey | WJQOOZQOGRKBNK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate?
The IUPAC name of [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate (CID 24593473) is [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate.
What is the SMILES notation for [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate?
The canonical SMILES for [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate is Cc1oc(NC(=O)COC(=O)C2(c3ccc(Cl)cc3)CCC2)c(C#N)c1C.
What is the InChIKey of [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate?
The InChIKey is WJQOOZQOGRKBNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN2O4/c1-12-13(2)27-18(16(12)10-22)23-17(24)11-26-19(25)20(8-3-9-20)14-4-6-15(21)7-5-14/h4-7H,3,8-9,11H2,1-2H3,(H,23,24).
What are the key properties of [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate?
[2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate has a molecular weight of 386.84 g/mol, XLogP of 4.03, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]-2-oxoethyl] 1-(4-chlorophenyl)cyclobutane-1-carboxylate is sourced from PubChem (CID 24593473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).