C17H23F3N4O3 — CID 24596265
N-[2-(2-methoxyethylamino)-2-oxoethyl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 24596265) has the molecular formula C17H23F3N4O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)-2-oxoethyl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(2-methoxyethylamino)-2-oxoethyl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24596265 |
| Molecular Formula | C17H23F3N4O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-[2-(2-methoxyethylamino)-2-oxoethyl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | COCCNC(=O)CNC(=O)C1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H23F3N4O3/c1-27-9-6-21-15(25)11-23-16(26)12-4-7-24(8-5-12)14-3-2-13(10-22-14)17(18,19)20/h2-3,10,12H,4-9,11H2,1H3,(H,21,25)(H,23,26) |
| InChIKey | BYWKUQBMNAJUTD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|