C19H16N4O4S2 — CID 24597839
3-(furan-2-yl)-1-phenyl-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrazole-5-carboxamide (PubChem CID 24597839) has the molecular formula C19H16N4O4S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-phenyl-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrazole-5-carboxamide.
| Compound Name | 3-(furan-2-yl)-1-phenyl-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 24597839 |
| Molecular Formula | C19H16N4O4S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 3-(furan-2-yl)-1-phenyl-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrazole-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cc(-c3ccco3)nn2-c2ccccc2)s1 |
| InChI | InChI=1S/C19H16N4O4S2/c20-29(25,26)18-9-8-14(28-18)12-21-19(24)16-11-15(17-7-4-10-27-17)22-23(16)13-5-2-1-3-6-13/h1-11H,12H2,(H,21,24)(H2,20,25,26) |
| InChIKey | VVTLRDSZWKZDBB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |