C19H25N3OS — CID 24598085
2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-2-phenylacetamide (PubChem CID 24598085) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-2-phenylacetamide.
| Compound Name | 2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 24598085 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-2-phenylacetamide |
| SMILES | Cc1nc(SC(C(N)=O)c2ccccc2)n(C2CCCCC2)c1C |
| InChI | InChI=1S/C19H25N3OS/c1-13-14(2)22(16-11-7-4-8-12-16)19(21-13)24-17(18(20)23)15-9-5-3-6-10-15/h3,5-6,9-10,16-17H,4,7-8,11-12H2,1-2H3,(H2,20,23) |
| InChIKey | SAXIVUDAXZPJQR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |