About 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide
2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide (PubChem CID 24598212) has the molecular formula C20H21ClN4O3
and a molecular weight of 400.87 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide.
Molecular Properties
| Compound Name | 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide |
| PubChem CID | 24598212 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide |
| SMILES | CCn1c(NNC(=O)C(C)(C)Oc2ccc(Cl)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H21ClN4O3/c1-4-25-17(26)15-7-5-6-8-16(15)22-19(25)24-23-18(27)20(2,3)28-14-11-9-13(21)10-12-14/h5-12H,4H2,1-3H3,(H,22,24)(H,23,27) |
| InChIKey | LUVLFEKDLRPLID-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide?
The IUPAC name of 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide (CID 24598212) is 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide.
What is the SMILES notation for 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide?
The canonical SMILES for 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide is CCn1c(NNC(=O)C(C)(C)Oc2ccc(Cl)cc2)nc2ccccc2c1=O.
What is the InChIKey of 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide?
The InChIKey is LUVLFEKDLRPLID-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClN4O3/c1-4-25-17(26)15-7-5-6-8-16(15)22-19(25)24-23-18(27)20(2,3)28-14-11-9-13(21)10-12-14/h5-12H,4H2,1-3H3,(H,22,24)(H,23,27).
What are the key properties of 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide?
2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide has a molecular weight of 400.87 g/mol, XLogP of 3.37, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-methylpropanehydrazide is sourced from PubChem (CID 24598212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).