C17H15N5O2S2 — CID 24598436
5-(furan-2-yl)-2-[1-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 24598436) has the molecular formula C17H15N5O2S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 5-(furan-2-yl)-2-[1-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(furan-2-yl)-2-[1-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24598436 |
| Molecular Formula | C17H15N5O2S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 5-(furan-2-yl)-2-[1-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1cnnc1SC(C)c1nc2scc(-c3ccco3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H15N5O2S2/c1-3-6-22-9-18-21-17(22)26-10(2)14-19-15(23)13-11(8-25-16(13)20-14)12-5-4-7-24-12/h3-5,7-10H,1,6H2,2H3,(H,19,20,23) |
| InChIKey | CFEWBBNZUACBTQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|