C22H21N5O5S — CID 24598489
1-[2-[3-(furan-2-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 24598489) has the molecular formula C22H21N5O5S and a molecular weight of 467.51 g/mol. Its IUPAC name is 1-[2-[3-(furan-2-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[2-[3-(furan-2-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 24598489 |
| Molecular Formula | C22H21N5O5S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 1-[2-[3-(furan-2-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)N2N=C(c3cccs3)CC2c2ccco2)c1=O |
| InChI | InChI=1S/C22H21N5O5S/c1-3-9-24-20(29)25(10-4-2)22(31)26(21(24)30)14-19(28)27-16(17-7-5-11-32-17)13-15(23-27)18-8-6-12-33-18/h3-8,11-12,16H,1-2,9-10,13-14H2 |
| InChIKey | ARKSSCBARKALAJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 111.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|