About 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide
2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide (PubChem CID 24598889) has the molecular formula C21H20ClN3O3S
and a molecular weight of 429.93 g/mol. Its IUPAC name is 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide.
Molecular Properties
| Compound Name | 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide |
| PubChem CID | 24598889 |
| Molecular Formula | C21H20ClN3O3S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide |
| SMILES | CC(=O)N(c1nc(COc2ccc(Cl)cc2C(N)=O)cs1)c1cccc(C)c1C |
| InChI | InChI=1S/C21H20ClN3O3S/c1-12-5-4-6-18(13(12)2)25(14(3)26)21-24-16(11-29-21)10-28-19-8-7-15(22)9-17(19)20(23)27/h4-9,11H,10H2,1-3H3,(H2,23,27) |
| InChIKey | DIWXESRHBOEMAT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide?
The IUPAC name of 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide (CID 24598889) is 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide.
What is the SMILES notation for 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide?
The canonical SMILES for 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide is CC(=O)N(c1nc(COc2ccc(Cl)cc2C(N)=O)cs1)c1cccc(C)c1C.
What is the InChIKey of 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide?
The InChIKey is DIWXESRHBOEMAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20ClN3O3S/c1-12-5-4-6-18(13(12)2)25(14(3)26)21-24-16(11-29-21)10-28-19-8-7-15(22)9-17(19)20(23)27/h4-9,11H,10H2,1-3H3,(H2,23,27).
What are the key properties of 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide?
2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide has a molecular weight of 429.93 g/mol, XLogP of 4.78, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methoxy]-5-chlorobenzamide is sourced from PubChem (CID 24598889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).