C22H15N3O3 — CID 24599418
N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-(2-cyanophenoxy)acetamide (PubChem CID 24599418) has the molecular formula C22H15N3O3 and a molecular weight of 369.38 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-(2-cyanophenoxy)acetamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-(2-cyanophenoxy)acetamide |
|---|---|
| PubChem CID | 24599418 |
| Molecular Formula | C22H15N3O3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-(2-cyanophenoxy)acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C22H15N3O3/c23-13-16-5-1-3-7-19(16)27-14-21(26)24-17-11-9-15(10-12-17)22-25-18-6-2-4-8-20(18)28-22/h1-12H,14H2,(H,24,26) |
| InChIKey | IVFJKQYGLUOWHC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |