About 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one
5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one (PubChem CID 24599512) has the molecular formula C18H17FN2O4
and a molecular weight of 344.34 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one |
| PubChem CID | 24599512 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one |
| SMILES | COc1ccc(OCCCn2nc(-c3ccc(F)cc3)oc2=O)cc1 |
| InChI | InChI=1S/C18H17FN2O4/c1-23-15-7-9-16(10-8-15)24-12-2-11-21-18(22)25-17(20-21)13-3-5-14(19)6-4-13/h3-10H,2,11-12H2,1H3 |
| InChIKey | FNFFKXLUZNUNLG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one?
The IUPAC name of 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one (CID 24599512) is 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one?
The canonical SMILES for 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one is COc1ccc(OCCCn2nc(-c3ccc(F)cc3)oc2=O)cc1.
What is the InChIKey of 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one?
The InChIKey is FNFFKXLUZNUNLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN2O4/c1-23-15-7-9-16(10-8-15)24-12-2-11-21-18(22)25-17(20-21)13-3-5-14(19)6-4-13/h3-10H,2,11-12H2,1H3.
What are the key properties of 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one?
5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one has a molecular weight of 344.34 g/mol, XLogP of 3.12, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-3-[3-(4-methoxyphenoxy)propyl]-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 24599512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).