C20H24F3N5O3S — CID 24601721
2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 24601721) has the molecular formula C20H24F3N5O3S and a molecular weight of 471.51 g/mol. Its IUPAC name is 2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 24601721 |
| Molecular Formula | C20H24F3N5O3S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CC(Sc1nnc(N2CCOCC2)n1CC1CCCO1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H24F3N5O3S/c1-12(18(29)24-15-5-4-14(21)16(22)17(15)23)32-20-26-25-19(27-6-9-30-10-7-27)28(20)11-13-3-2-8-31-13/h4-5,12-13H,2-3,6-11H2,1H3,(H,24,29) |
| InChIKey | KNMGIMWFZCMTCJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|