About 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one
7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 2460244) has the molecular formula C20H20Cl2N4O
and a molecular weight of 403.31 g/mol. Its IUPAC name is 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 2460244 |
| Molecular Formula | C20H20Cl2N4O |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1c(Cl)cn2c(=O)cc(CN3CCN(c4ccccc4)CC3)nc2c1Cl |
| InChI | InChI=1S/C20H20Cl2N4O/c1-14-17(21)13-26-18(27)11-15(23-20(26)19(14)22)12-24-7-9-25(10-8-24)16-5-3-2-4-6-16/h2-6,11,13H,7-10,12H2,1H3 |
| InChIKey | GFYXGKDVJJHMTA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one (CID 2460244) is 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one is Cc1c(Cl)cn2c(=O)cc(CN3CCN(c4ccccc4)CC3)nc2c1Cl.
What is the InChIKey of 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is GFYXGKDVJJHMTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20Cl2N4O/c1-14-17(21)13-26-18(27)11-15(23-20(26)19(14)22)12-24-7-9-25(10-8-24)16-5-3-2-4-6-16/h2-6,11,13H,7-10,12H2,1H3.
What are the key properties of 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one?
7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 403.31 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dichloro-8-methyl-2-[(4-phenylpiperazin-1-yl)methyl]pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 2460244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).