C18H15F3N2O2S — CID 24602975
2-[3-(trifluoromethyl)phenyl]sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 24602975) has the molecular formula C18H15F3N2O2S and a molecular weight of 380.39 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 24602975 |
| Molecular Formula | C18H15F3N2O2S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C18H15F3N2O2S/c19-18(20,21)12-4-3-5-13(10-12)26(24,25)23-9-8-17-15(11-23)14-6-1-2-7-16(14)22-17/h1-7,10,22H,8-9,11H2 |
| InChIKey | MIJIVNDGFMEALW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|