C19H17N2O4- — CID 2460332
3-[2-(2,5-dimethylphenoxy)ethyl]-4-oxophthalazine-1-carboxylate (PubChem CID 2460332) has the molecular formula C19H17N2O4- and a molecular weight of 337.36 g/mol. Its IUPAC name is 3-[2-(2,5-dimethylphenoxy)ethyl]-4-oxophthalazine-1-carboxylate.
| Compound Name | 3-[2-(2,5-dimethylphenoxy)ethyl]-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2460332 |
| Molecular Formula | C19H17N2O4- |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-[2-(2,5-dimethylphenoxy)ethyl]-4-oxophthalazine-1-carboxylate |
| SMILES | Cc1ccc(C)c(OCCn2nc(C(=O)[O-])c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C19H18N2O4/c1-12-7-8-13(2)16(11-12)25-10-9-21-18(22)15-6-4-3-5-14(15)17(20-21)19(23)24/h3-8,11H,9-10H2,1-2H3,(H,23,24)/p-1 |
| InChIKey | QIYPLSSWYHRAHT-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 84.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |