About (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate
(2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate (PubChem CID 24603447) has the molecular formula C18H17NO3
and a molecular weight of 295.34 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate.
Molecular Properties
| Compound Name | (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
| PubChem CID | 24603447 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2CC(=O)Nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C18H17NO3/c1-11-7-8-16(12(2)9-11)22-18(21)14-10-17(20)19-15-6-4-3-5-13(14)15/h3-9,14H,10H2,1-2H3,(H,19,20) |
| InChIKey | FBDNWWPAPHNBPT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
The IUPAC name of (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate (CID 24603447) is (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate.
What is the SMILES notation for (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
The canonical SMILES for (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate is Cc1ccc(OC(=O)C2CC(=O)Nc3ccccc32)c(C)c1.
What is the InChIKey of (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
The InChIKey is FBDNWWPAPHNBPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO3/c1-11-7-8-16(12(2)9-11)22-18(21)14-10-17(20)19-15-6-4-3-5-13(14)15/h3-9,14H,10H2,1-2H3,(H,19,20).
What are the key properties of (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
(2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate has a molecular weight of 295.34 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethylphenyl) 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate is sourced from PubChem (CID 24603447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).