C19H19F3N4S — CID 24605077
2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-4-methyl-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 24605077) has the molecular formula C19H19F3N4S and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-4-methyl-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-4-methyl-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 24605077 |
| Molecular Formula | C19H19F3N4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-4-methyl-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccccc2)nn(CN(Cc2ccccc2)CC(F)(F)F)c1=S |
| InChI | InChI=1S/C19H19F3N4S/c1-24-17(16-10-6-3-7-11-16)23-26(18(24)27)14-25(13-19(20,21)22)12-15-8-4-2-5-9-15/h2-11H,12-14H2,1H3 |
| InChIKey | XXTGDSVYFIZPKZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|