C19H19F3N4OS — CID 24605115
2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-4-(2-methoxyphenyl)-1,2,4-triazole-3-thione (PubChem CID 24605115) has the molecular formula C19H19F3N4OS and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-4-(2-methoxyphenyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-4-(2-methoxyphenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 24605115 |
| Molecular Formula | C19H19F3N4OS |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-4-(2-methoxyphenyl)-1,2,4-triazole-3-thione |
| SMILES | COc1ccccc1-n1cnn(CN(Cc2ccccc2)CC(F)(F)F)c1=S |
| InChI | InChI=1S/C19H19F3N4OS/c1-27-17-10-6-5-9-16(17)25-13-23-26(18(25)28)14-24(12-19(20,21)22)11-15-7-3-2-4-8-15/h2-10,13H,11-12,14H2,1H3 |
| InChIKey | UEMJGWFPRTWTAL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|