C19H31N5O4S3 — CID 24605536
2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide (PubChem CID 24605536) has the molecular formula C19H31N5O4S3 and a molecular weight of 489.69 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 24605536 |
| Molecular Formula | C19H31N5O4S3 |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nn(CN(CC(C)C)C3CCS(=O)(=O)C3)c(=S)n2c1 |
| InChI | InChI=1S/C19H31N5O4S3/c1-5-22(6-2)31(27,28)17-7-8-18-20-24(19(29)23(18)12-17)14-21(11-15(3)4)16-9-10-30(25,26)13-16/h7-8,12,15-16H,5-6,9-11,13-14H2,1-4H3 |
| InChIKey | DGBJCPZOLJAXMZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 96.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|