C18H29N5O4S3 — CID 24605628
2-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide (PubChem CID 24605628) has the molecular formula C18H29N5O4S3 and a molecular weight of 475.66 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 24605628 |
| Molecular Formula | C18H29N5O4S3 |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
| SMILES | CCCN(Cn1nc2ccc(S(=O)(=O)N(CC)CC)cn2c1=S)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H29N5O4S3/c1-4-10-20(15-9-11-29(24,25)13-15)14-23-18(28)22-12-16(7-8-17(22)19-23)30(26,27)21(5-2)6-3/h7-8,12,15H,4-6,9-11,13-14H2,1-3H3 |
| InChIKey | NBDHZUVLHVNLBJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 96.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|