C24H31N5O2S — CID 24606194
2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]-4-methyl-5-pyridin-3-yl-1,2,4-triazole-3-thione (PubChem CID 24606194) has the molecular formula C24H31N5O2S and a molecular weight of 453.61 g/mol. Its IUPAC name is 2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]-4-methyl-5-pyridin-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]-4-methyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 24606194 |
| Molecular Formula | C24H31N5O2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]-4-methyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
| SMILES | COc1cc(CCC2CCN(Cn3nc(-c4cccnc4)n(C)c3=S)CC2)cc(OC)c1 |
| InChI | InChI=1S/C24H31N5O2S/c1-27-23(20-5-4-10-25-16-20)26-29(24(27)32)17-28-11-8-18(9-12-28)6-7-19-13-21(30-2)15-22(14-19)31-3/h4-5,10,13-16,18H,6-9,11-12,17H2,1-3H3 |
| InChIKey | LJQRVAAXSXXFKW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|