About 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine
2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine (PubChem CID 24606851) has the molecular formula C19H18N6O2
and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine |
| PubChem CID | 24606851 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1c(N2CCC(c3nc4ccccc4[nH]3)CC2)nc2ccccn12 |
| InChI | InChI=1S/C19H18N6O2/c26-25(27)19-18(22-16-7-3-4-10-24(16)19)23-11-8-13(9-12-23)17-20-14-5-1-2-6-15(14)21-17/h1-7,10,13H,8-9,11-12H2,(H,20,21) |
| InChIKey | GBZRVXRSWCXLPX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine?
The IUPAC name of 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine (CID 24606851) is 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine?
The canonical SMILES for 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine is O=[N+]([O-])c1c(N2CCC(c3nc4ccccc4[nH]3)CC2)nc2ccccn12.
What is the InChIKey of 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine?
The InChIKey is GBZRVXRSWCXLPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N6O2/c26-25(27)19-18(22-16-7-3-4-10-24(16)19)23-11-8-13(9-12-23)17-20-14-5-1-2-6-15(14)21-17/h1-7,10,13H,8-9,11-12H2,(H,20,21).
What are the key properties of 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine?
2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine has a molecular weight of 362.39 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-nitroimidazo[1,2-a]pyridine is sourced from PubChem (CID 24606851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).