C12H10F3N5O2S2 — CID 2460687
2-[[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2460687) has the molecular formula C12H10F3N5O2S2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 2-[[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2460687 |
| Molecular Formula | C12H10F3N5O2S2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 2-[[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Nc1nnc(SCC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C12H10F3N5O2S2/c13-5-1-2-6(10(15)9(5)14)18-7(21)3-17-8(22)4-23-12-20-19-11(16)24-12/h1-2H,3-4H2,(H2,16,19)(H,17,22)(H,18,21) |
| InChIKey | QYAPJAOUYYVUKP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|