C17H15IN2O2S — CID 24607270
1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-(3-iodophenoxy)ethanone (PubChem CID 24607270) has the molecular formula C17H15IN2O2S and a molecular weight of 438.29 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-(3-iodophenoxy)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-(3-iodophenoxy)ethanone |
|---|---|
| PubChem CID | 24607270 |
| Molecular Formula | C17H15IN2O2S |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-(3-iodophenoxy)ethanone |
| SMILES | Cc1cc(C(=O)COc2cccc(I)c2)c(C)n1-c1nccs1 |
| InChI | InChI=1S/C17H15IN2O2S/c1-11-8-15(12(2)20(11)17-19-6-7-23-17)16(21)10-22-14-5-3-4-13(18)9-14/h3-9H,10H2,1-2H3 |
| InChIKey | NSDJVCPLWVTIDM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|