C23H26N4O3S — CID 24607688
1-(1,3-benzoxazol-2-yl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)piperidine-4-carbohydrazide (PubChem CID 24607688) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 24607688 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)piperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(c2nc3ccccc3o2)CC1)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C23H26N4O3S/c28-21(25-26-22(29)20-14-16-6-2-1-3-9-19(16)31-20)15-10-12-27(13-11-15)23-24-17-7-4-5-8-18(17)30-23/h4-5,7-8,14-15H,1-3,6,9-13H2,(H,25,28)(H,26,29) |
| InChIKey | SXGAWHCEMOEXQC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|