C18H14F3N3O4 — CID 24607749
N'-(3-methyl-1-benzofuran-2-carbonyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide (PubChem CID 24607749) has the molecular formula C18H14F3N3O4 and a molecular weight of 393.32 g/mol. Its IUPAC name is N'-(3-methyl-1-benzofuran-2-carbonyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide.
| Compound Name | N'-(3-methyl-1-benzofuran-2-carbonyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 24607749 |
| Molecular Formula | C18H14F3N3O4 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N'-(3-methyl-1-benzofuran-2-carbonyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(OCC(F)(F)F)nc2)oc2ccccc12 |
| InChI | InChI=1S/C18H14F3N3O4/c1-10-12-4-2-3-5-13(12)28-15(10)17(26)24-23-16(25)11-6-7-14(22-8-11)27-9-18(19,20)21/h2-8H,9H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | NZPIMGNTYOXKJK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|