C21H19ClN4O2S2 — CID 24607862
1-(4-chlorobenzoyl)-3-[[5-[(E)-2-thiophen-2-ylethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one (PubChem CID 24607862) has the molecular formula C21H19ClN4O2S2 and a molecular weight of 459.00 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-3-[[5-[(E)-2-thiophen-2-ylethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one.
| Compound Name | 1-(4-chlorobenzoyl)-3-[[5-[(E)-2-thiophen-2-ylethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 24607862 |
| Molecular Formula | C21H19ClN4O2S2 |
| Molecular Weight | 459.00 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 1-(4-chlorobenzoyl)-3-[[5-[(E)-2-thiophen-2-ylethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCCC(Sc2n[nH]c(/C=C/c3cccs3)n2)C1=O |
| InChI | InChI=1S/C21H19ClN4O2S2/c22-15-8-6-14(7-9-15)19(27)26-12-2-1-5-17(20(26)28)30-21-23-18(24-25-21)11-10-16-4-3-13-29-16/h3-4,6-11,13,17H,1-2,5,12H2,(H,23,24,25)/b11-10+ |
| InChIKey | CXLTVSJQNBEFIT-ZHACJKMWSA-N |
| XLogP | 5.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.00 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|