C24H26N2O5S — CID 24608199
(E)-1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-(7-methoxy-1-benzofuran-2-yl)prop-2-en-1-one (PubChem CID 24608199) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is (E)-1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-(7-methoxy-1-benzofuran-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-(7-methoxy-1-benzofuran-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24608199 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | (E)-1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-(7-methoxy-1-benzofuran-2-yl)prop-2-en-1-one |
| SMILES | COc1cccc2cc(/C=C/C(=O)N3CCN(S(=O)(=O)c4cc(C)ccc4C)CC3)oc12 |
| InChI | InChI=1S/C24H26N2O5S/c1-17-7-8-18(2)22(15-17)32(28,29)26-13-11-25(12-14-26)23(27)10-9-20-16-19-5-4-6-21(30-3)24(19)31-20/h4-10,15-16H,11-14H2,1-3H3/b10-9+ |
| InChIKey | CMRNBNMEXYDRJX-MDZDMXLPSA-N |
| XLogP | 3.60 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|