About [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate (PubChem CID 2460858) has the molecular formula C19H14F3NO3
and a molecular weight of 361.32 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate |
| PubChem CID | 2460858 |
| Molecular Formula | C19H14F3NO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate |
| SMILES | O=C(COC(=O)c1c2ccccc2cc2ccccc12)NCC(F)(F)F |
| InChI | InChI=1S/C19H14F3NO3/c20-19(21,22)11-23-16(24)10-26-18(25)17-14-7-3-1-5-12(14)9-13-6-2-4-8-15(13)17/h1-9H,10-11H2,(H,23,24) |
| InChIKey | NKPRJXLGKMDJJU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate?
The IUPAC name of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate (CID 2460858) is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate.
What is the SMILES notation for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate?
The canonical SMILES for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate is O=C(COC(=O)c1c2ccccc2cc2ccccc12)NCC(F)(F)F.
What is the InChIKey of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate?
The InChIKey is NKPRJXLGKMDJJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3NO3/c20-19(21,22)11-23-16(24)10-26-18(25)17-14-7-3-1-5-12(14)9-13-6-2-4-8-15(13)17/h1-9H,10-11H2,(H,23,24).
What are the key properties of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate?
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate has a molecular weight of 361.32 g/mol, XLogP of 3.83, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] anthracene-9-carboxylate is sourced from PubChem (CID 2460858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).