About (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate
(4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate (PubChem CID 2461037) has the molecular formula C21H19BrO4
and a molecular weight of 415.28 g/mol. Its IUPAC name is (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate.
Molecular Properties
| Compound Name | (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate |
| PubChem CID | 2461037 |
| Molecular Formula | C21H19BrO4 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate |
| SMILES | CCC(=O)c1cc(Br)ccc1OC(=O)Cc1coc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C21H19BrO4/c1-4-18(23)17-10-15(22)5-6-19(17)26-21(24)9-14-11-25-20-8-13(3)12(2)7-16(14)20/h5-8,10-11H,4,9H2,1-3H3 |
| InChIKey | RIXIXQIURQCFMH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate?
The IUPAC name of (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate (CID 2461037) is (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate.
What is the SMILES notation for (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate?
The canonical SMILES for (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate is CCC(=O)c1cc(Br)ccc1OC(=O)Cc1coc2cc(C)c(C)cc12.
What is the InChIKey of (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate?
The InChIKey is RIXIXQIURQCFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19BrO4/c1-4-18(23)17-10-15(22)5-6-19(17)26-21(24)9-14-11-25-20-8-13(3)12(2)7-16(14)20/h5-8,10-11H,4,9H2,1-3H3.
What are the key properties of (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate?
(4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate has a molecular weight of 415.28 g/mol, XLogP of 5.55, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-propanoylphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate is sourced from PubChem (CID 2461037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).