C25H27N5O2 — CID 24610413
[4-(piperidine-1-carbonyl)piperazin-1-yl]-(2-pyridin-3-ylquinolin-4-yl)methanone (PubChem CID 24610413) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is [4-(piperidine-1-carbonyl)piperazin-1-yl]-(2-pyridin-3-ylquinolin-4-yl)methanone.
| Compound Name | [4-(piperidine-1-carbonyl)piperazin-1-yl]-(2-pyridin-3-ylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 24610413 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | [4-(piperidine-1-carbonyl)piperazin-1-yl]-(2-pyridin-3-ylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2cccnc2)nc2ccccc12)N1CCN(C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C25H27N5O2/c31-24(28-13-15-30(16-14-28)25(32)29-11-4-1-5-12-29)21-17-23(19-7-6-10-26-18-19)27-22-9-3-2-8-20(21)22/h2-3,6-10,17-18H,1,4-5,11-16H2 |
| InChIKey | NNWKOKSIBTYNNU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |