C17H15ClN2O2S — CID 24610850
(E)-3-(5-chlorothiophen-2-yl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide (PubChem CID 24610850) has the molecular formula C17H15ClN2O2S and a molecular weight of 346.84 g/mol. Its IUPAC name is (E)-3-(5-chlorothiophen-2-yl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(5-chlorothiophen-2-yl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24610850 |
| Molecular Formula | C17H15ClN2O2S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | (E)-3-(5-chlorothiophen-2-yl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)s1)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C17H15ClN2O2S/c18-15-9-7-14(23-15)8-10-16(21)19-12-3-5-13(6-4-12)20-11-1-2-17(20)22/h3-10H,1-2,11H2,(H,19,21)/b10-8+ |
| InChIKey | YQYBILMVIHCUAR-CSKARUKUSA-N |
| XLogP | 4.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|