About 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one
7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one (PubChem CID 2461259) has the molecular formula C22H21NO3
and a molecular weight of 347.41 g/mol. Its IUPAC name is 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one.
Molecular Properties
| Compound Name | 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one |
| PubChem CID | 2461259 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one |
| SMILES | COc1ccc2c(CN3CC=C(c4ccccc4)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H21NO3/c1-25-19-7-8-20-18(13-22(24)26-21(20)14-19)15-23-11-9-17(10-12-23)16-5-3-2-4-6-16/h2-9,13-14H,10-12,15H2,1H3 |
| InChIKey | OSDUWIFNRWRJRD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one?
The IUPAC name of 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one (CID 2461259) is 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one.
What is the SMILES notation for 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one?
The canonical SMILES for 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one is COc1ccc2c(CN3CC=C(c4ccccc4)CC3)cc(=O)oc2c1.
What is the InChIKey of 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one?
The InChIKey is OSDUWIFNRWRJRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO3/c1-25-19-7-8-20-18(13-22(24)26-21(20)14-19)15-23-11-9-17(10-12-23)16-5-3-2-4-6-16/h2-9,13-14H,10-12,15H2,1H3.
What are the key properties of 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one?
7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one has a molecular weight of 347.41 g/mol, XLogP of 4.09, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]chromen-2-one is sourced from PubChem (CID 2461259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).