C21H21FN2O2 — CID 24612610
1-[1-(4-fluorophenyl)ethyl]-3-[(6-methoxynaphthalen-2-yl)methyl]urea (PubChem CID 24612610) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)ethyl]-3-[(6-methoxynaphthalen-2-yl)methyl]urea.
| Compound Name | 1-[1-(4-fluorophenyl)ethyl]-3-[(6-methoxynaphthalen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 24612610 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[1-(4-fluorophenyl)ethyl]-3-[(6-methoxynaphthalen-2-yl)methyl]urea |
| SMILES | COc1ccc2cc(CNC(=O)NC(C)c3ccc(F)cc3)ccc2c1 |
| InChI | InChI=1S/C21H21FN2O2/c1-14(16-5-8-19(22)9-6-16)24-21(25)23-13-15-3-4-18-12-20(26-2)10-7-17(18)11-15/h3-12,14H,13H2,1-2H3,(H2,23,24,25) |
| InChIKey | MEMAYSQIPJEREA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |