C23H25N3O6 — CID 24612629
1-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-3-[(6-methoxynaphthalen-2-yl)methyl]urea (PubChem CID 24612629) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is 1-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-3-[(6-methoxynaphthalen-2-yl)methyl]urea.
| Compound Name | 1-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-3-[(6-methoxynaphthalen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 24612629 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-3-[(6-methoxynaphthalen-2-yl)methyl]urea |
| SMILES | COc1ccc2cc(CNC(=O)NCCc3cc(OC)c(OC)cc3[N+](=O)[O-])ccc2c1 |
| InChI | InChI=1S/C23H25N3O6/c1-30-19-7-6-16-10-15(4-5-17(16)11-19)14-25-23(27)24-9-8-18-12-21(31-2)22(32-3)13-20(18)26(28)29/h4-7,10-13H,8-9,14H2,1-3H3,(H2,24,25,27) |
| InChIKey | OWHFMPXIYLSWAC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|