About 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one
2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 2461264) has the molecular formula C25H25N3OS
and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 2461264 |
| Molecular Formula | C25H25N3OS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CN2CCC(Cc3ccccc3)CC2)nc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C25H25N3OS/c29-24-23-21(20-9-5-2-6-10-20)17-30-25(23)27-22(26-24)16-28-13-11-19(12-14-28)15-18-7-3-1-4-8-18/h1-10,17,19H,11-16H2,(H,26,27,29) |
| InChIKey | PTKOYJFFSSUAOM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (CID 2461264) is 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one is O=c1[nH]c(CN2CCC(Cc3ccccc3)CC2)nc2scc(-c3ccccc3)c12.
What is the InChIKey of 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one?
The InChIKey is PTKOYJFFSSUAOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N3OS/c29-24-23-21(20-9-5-2-6-10-20)17-30-25(23)27-22(26-24)16-28-13-11-19(12-14-28)15-18-7-3-1-4-8-18/h1-10,17,19H,11-16H2,(H,26,27,29).
What are the key properties of 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one?
2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one has a molecular weight of 415.56 g/mol, XLogP of 5.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-benzylpiperidin-1-yl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 2461264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).