C20H21ClN4O2S — CID 24614277
(E)-N-(3-chloro-2-morpholin-4-ylphenyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide (PubChem CID 24614277) has the molecular formula C20H21ClN4O2S and a molecular weight of 416.93 g/mol. Its IUPAC name is (E)-N-(3-chloro-2-morpholin-4-ylphenyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-chloro-2-morpholin-4-ylphenyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 24614277 |
| Molecular Formula | C20H21ClN4O2S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (E)-N-(3-chloro-2-morpholin-4-ylphenyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
| SMILES | Cc1cn2c(/C=C/C(=O)Nc3cccc(Cl)c3N3CCOCC3)c(C)nc2s1 |
| InChI | InChI=1S/C20H21ClN4O2S/c1-13-12-25-17(14(2)22-20(25)28-13)6-7-18(26)23-16-5-3-4-15(21)19(16)24-8-10-27-11-9-24/h3-7,12H,8-11H2,1-2H3,(H,23,26)/b7-6+ |
| InChIKey | CPSHSGPWSDFXRU-VOTSOKGWSA-N |
| XLogP | 4.15 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|