About N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide
N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide (PubChem CID 2461467) has the molecular formula C22H21N3O2S
and a molecular weight of 391.50 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide |
| PubChem CID | 2461467 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)N(Cc1ccco1)Cc1cccs1 |
| InChI | InChI=1S/C22H21N3O2S/c1-16-21(17(2)25(23-16)18-8-4-3-5-9-18)22(26)24(14-19-10-6-12-27-19)15-20-11-7-13-28-20/h3-13H,14-15H2,1-2H3 |
| InChIKey | QRAFEZOPXZCRKO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide?
The IUPAC name of N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide (CID 2461467) is N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide.
What is the SMILES notation for N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide?
The canonical SMILES for N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide is Cc1nn(-c2ccccc2)c(C)c1C(=O)N(Cc1ccco1)Cc1cccs1.
What is the InChIKey of N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide?
The InChIKey is QRAFEZOPXZCRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O2S/c1-16-21(17(2)25(23-16)18-8-4-3-5-9-18)22(26)24(14-19-10-6-12-27-19)15-20-11-7-13-28-20/h3-13H,14-15H2,1-2H3.
What are the key properties of N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide?
N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide has a molecular weight of 391.50 g/mol, XLogP of 4.99, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-3,5-dimethyl-1-phenyl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide is sourced from PubChem (CID 2461467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).