C16H17NO4S — CID 2461500
tert-butyl 2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetate (PubChem CID 2461500) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is tert-butyl 2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetate.
| Compound Name | tert-butyl 2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetate |
|---|---|
| PubChem CID | 2461500 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | tert-butyl 2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C16H17NO4S/c1-16(2,3)21-14(18)10-17-12-8-4-6-11-7-5-9-13(15(11)12)22(17,19)20/h4-9H,10H2,1-3H3 |
| InChIKey | NDCCNBLRJJCVCJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |