C20H24N4O2S — CID 24615315
ethyl 6-(4-imidazol-1-ylphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 24615315) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is ethyl 6-(4-imidazol-1-ylphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-(4-imidazol-1-ylphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 24615315 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | ethyl 6-(4-imidazol-1-ylphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCN1C(=S)NC(c2ccc(-n3ccnc3)cc2)C(C(=O)OCC)=C1C |
| InChI | InChI=1S/C20H24N4O2S/c1-4-11-24-14(3)17(19(25)26-5-2)18(22-20(24)27)15-6-8-16(9-7-15)23-12-10-21-13-23/h6-10,12-13,18H,4-5,11H2,1-3H3,(H,22,27) |
| InChIKey | FCTKFFNGIDQUBB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|