C24H24N4O3S — CID 24616214
5-ethyl-4-methyl-N'-[3-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoyl]thiophene-2-carbohydrazide (PubChem CID 24616214) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N'-[3-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoyl]thiophene-2-carbohydrazide.
| Compound Name | 5-ethyl-4-methyl-N'-[3-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 24616214 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 5-ethyl-4-methyl-N'-[3-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoyl]thiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)c2cccc(OCc3cn4cccc(C)c4n3)c2)cc1C |
| InChI | InChI=1S/C24H24N4O3S/c1-4-20-16(3)11-21(32-20)24(30)27-26-23(29)17-8-5-9-19(12-17)31-14-18-13-28-10-6-7-15(2)22(28)25-18/h5-13H,4,14H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | WIKAFAKZECDVTR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|