C23H20N4O — CID 24617390
(E)-3-naphthalen-1-yl-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 24617390) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is (E)-3-naphthalen-1-yl-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-naphthalen-1-yl-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 24617390 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (E)-3-naphthalen-1-yl-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc2ccccc12)N1CCCC1c1nnc2ccccn12 |
| InChI | InChI=1S/C23H20N4O/c28-22(14-13-18-9-5-8-17-7-1-2-10-19(17)18)26-16-6-11-20(26)23-25-24-21-12-3-4-15-27(21)23/h1-5,7-10,12-15,20H,6,11,16H2/b14-13+ |
| InChIKey | RWWVLMVXBGPNTR-BUHFOSPRSA-N |
| XLogP | 4.26 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|