C14H10Cl2N4O — CID 24617612
5-[(3,5-dichlorophenoxy)methyl]-1-phenyltetrazole (PubChem CID 24617612) has the molecular formula C14H10Cl2N4O and a molecular weight of 321.17 g/mol. Its IUPAC name is 5-[(3,5-dichlorophenoxy)methyl]-1-phenyltetrazole.
| Compound Name | 5-[(3,5-dichlorophenoxy)methyl]-1-phenyltetrazole |
|---|---|
| PubChem CID | 24617612 |
| Molecular Formula | C14H10Cl2N4O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 5-[(3,5-dichlorophenoxy)methyl]-1-phenyltetrazole |
| SMILES | Clc1cc(Cl)cc(OCc2nnnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C14H10Cl2N4O/c15-10-6-11(16)8-13(7-10)21-9-14-17-18-19-20(14)12-4-2-1-3-5-12/h1-8H,9H2 |
| InChIKey | ADWBHRXQDKKSGE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |