About N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide
N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 2461878) has the molecular formula C27H27N3O2S
and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide.
Molecular Properties
| Compound Name | N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide |
| PubChem CID | 2461878 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | CCCCN(C(=O)C[C@@H](NC(=O)c1ccccc1)c1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C27H27N3O2S/c1-2-3-18-30(27-29-22-16-10-11-17-24(22)33-27)25(31)19-23(20-12-6-4-7-13-20)28-26(32)21-14-8-5-9-15-21/h4-17,23H,2-3,18-19H2,1H3,(H,28,32)/t23-/m1/s1 |
| InChIKey | HDAWIGJDGSGFCW-HSZRJFAPSA-N |
| XLogP | 5.99 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide?
The IUPAC name of N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide (CID 2461878) is N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide.
What is the SMILES notation for N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide?
The canonical SMILES for N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide is CCCCN(C(=O)C[C@@H](NC(=O)c1ccccc1)c1ccccc1)c1nc2ccccc2s1.
What is the InChIKey of N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide?
The InChIKey is HDAWIGJDGSGFCW-HSZRJFAPSA-N. The full InChI is InChI=1S/C27H27N3O2S/c1-2-3-18-30(27-29-22-16-10-11-17-24(22)33-27)25(31)19-23(20-12-6-4-7-13-20)28-26(32)21-14-8-5-9-15-21/h4-17,23H,2-3,18-19H2,1H3,(H,28,32)/t23-/m1/s1.
What are the key properties of N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide?
N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide has a molecular weight of 457.60 g/mol, XLogP of 5.99, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-3-[1,3-benzothiazol-2-yl(butyl)amino]-3-oxo-1-phenylpropyl]benzamide is sourced from PubChem (CID 2461878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).