About 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol
6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol (PubChem CID 2462079) has the molecular formula C18H19FN2O3
and a molecular weight of 330.36 g/mol. Its IUPAC name is 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol.
Molecular Properties
| Compound Name | 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol |
| PubChem CID | 2462079 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1CN1CCN(c3ccccc3F)CC1)OCO2 |
| InChI | InChI=1S/C18H19FN2O3/c19-14-3-1-2-4-15(14)21-7-5-20(6-8-21)11-13-9-17-18(10-16(13)22)24-12-23-17/h1-4,9-10,22H,5-8,11-12H2 |
| InChIKey | RVOCFMRPPYTCQT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol?
The IUPAC name of 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol (CID 2462079) is 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol.
What is the SMILES notation for 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol?
The canonical SMILES for 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol is Oc1cc2c(cc1CN1CCN(c3ccccc3F)CC1)OCO2.
What is the InChIKey of 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol?
The InChIKey is RVOCFMRPPYTCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN2O3/c19-14-3-1-2-4-15(14)21-7-5-20(6-8-21)11-13-9-17-18(10-16(13)22)24-12-23-17/h1-4,9-10,22H,5-8,11-12H2.
What are the key properties of 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol?
6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol has a molecular weight of 330.36 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol is sourced from PubChem (CID 2462079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).