About (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate
(4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate (PubChem CID 24622192) has the molecular formula C18H11N3O7S2
and a molecular weight of 445.43 g/mol. Its IUPAC name is (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate.
Molecular Properties
| Compound Name | (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate |
| PubChem CID | 24622192 |
| Molecular Formula | C18H11N3O7S2 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)Oc3ccc([N+](=O)[O-])cc3-c3cccs3)cc2[nH]c1=O |
| InChI | InChI=1S/C18H11N3O7S2/c22-17-18(23)20-14-9-11(4-5-13(14)19-17)30(26,27)28-15-6-3-10(21(24)25)8-12(15)16-2-1-7-29-16/h1-9H,(H,19,22)(H,20,23) |
| InChIKey | MYUVSXMENQBDEL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 152.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate?
The IUPAC name of (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate (CID 24622192) is (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate.
What is the SMILES notation for (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate?
The canonical SMILES for (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate is O=c1[nH]c2ccc(S(=O)(=O)Oc3ccc([N+](=O)[O-])cc3-c3cccs3)cc2[nH]c1=O.
What is the InChIKey of (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate?
The InChIKey is MYUVSXMENQBDEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3O7S2/c22-17-18(23)20-14-9-11(4-5-13(14)19-17)30(26,27)28-15-6-3-10(21(24)25)8-12(15)16-2-1-7-29-16/h1-9H,(H,19,22)(H,20,23).
What are the key properties of (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate?
(4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate has a molecular weight of 445.43 g/mol, XLogP of 2.62, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitro-2-thiophen-2-ylphenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate is sourced from PubChem (CID 24622192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).