C20H17N3O2S — CID 24622883
3-ethyl-4-oxo-N-(3-phenylprop-2-ynyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 24622883) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-ethyl-4-oxo-N-(3-phenylprop-2-ynyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-ethyl-4-oxo-N-(3-phenylprop-2-ynyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 24622883 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 3-ethyl-4-oxo-N-(3-phenylprop-2-ynyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | CCn1c(=S)[nH]c2cc(C(=O)NCC#Cc3ccccc3)ccc2c1=O |
| InChI | InChI=1S/C20H17N3O2S/c1-2-23-19(25)16-11-10-15(13-17(16)22-20(23)26)18(24)21-12-6-9-14-7-4-3-5-8-14/h3-5,7-8,10-11,13H,2,12H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | JPKXFXFTRSYWFY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|