C21H22N4O2S — CID 24623261
1,7-dicyclopropyl-5-(3-phenylpropylsulfanyl)pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 24623261) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1,7-dicyclopropyl-5-(3-phenylpropylsulfanyl)pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 1,7-dicyclopropyl-5-(3-phenylpropylsulfanyl)pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 24623261 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1,7-dicyclopropyl-5-(3-phenylpropylsulfanyl)pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2CC2)c2nc(C3CC3)nc(SCCCc3ccccc3)c12 |
| InChI | InChI=1S/C21H22N4O2S/c26-19-16-18(25(15-10-11-15)21(27)24-19)22-17(14-8-9-14)23-20(16)28-12-4-7-13-5-2-1-3-6-13/h1-3,5-6,14-15H,4,7-12H2,(H,24,26,27) |
| InChIKey | UMFWNGMHMCKZPT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|