About N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine
N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine (PubChem CID 24623530) has the molecular formula C18H16N6
and a molecular weight of 316.37 g/mol. Its IUPAC name is N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine.
Molecular Properties
| Compound Name | N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine |
| PubChem CID | 24623530 |
| Molecular Formula | C18H16N6 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine |
| SMILES | CC(Nc1ncnc2ccccc12)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C18H16N6/c1-13(14-6-8-15(9-7-14)24-12-19-10-22-24)23-18-16-4-2-3-5-17(16)20-11-21-18/h2-13H,1H3,(H,20,21,23) |
| InChIKey | SAJGADALXOFWKI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine?
The IUPAC name of N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine (CID 24623530) is N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine.
What is the SMILES notation for N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine?
The canonical SMILES for N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine is CC(Nc1ncnc2ccccc12)c1ccc(-n2cncn2)cc1.
What is the InChIKey of N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine?
The InChIKey is SAJGADALXOFWKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6/c1-13(14-6-8-15(9-7-14)24-12-19-10-22-24)23-18-16-4-2-3-5-17(16)20-11-21-18/h2-13H,1H3,(H,20,21,23).
What are the key properties of N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine?
N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine has a molecular weight of 316.37 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]quinazolin-4-amine is sourced from PubChem (CID 24623530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).