C20H18F3N3O3 — CID 24624365
N-(2-ethoxyphenyl)-4-methoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 24624365) has the molecular formula C20H18F3N3O3 and a molecular weight of 405.38 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-4-methoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | N-(2-ethoxyphenyl)-4-methoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 24624365 |
| Molecular Formula | C20H18F3N3O3 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-(2-ethoxyphenyl)-4-methoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1nn(-c2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C20H18F3N3O3/c1-3-29-16-10-5-4-9-15(16)24-19(27)18-17(28-2)12-26(25-18)14-8-6-7-13(11-14)20(21,22)23/h4-12H,3H2,1-2H3,(H,24,27) |
| InChIKey | HSQIPOYQKPHBCS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |